ChemNet > CAS > 23576-81-0 6-chloroimidazo[2,1-b][1,3]thiazole
23576-81-0 6-chloroimidazo[2,1-b][1,3]thiazole
| Naam product |
6-chloroimidazo[2,1-b][1,3]thiazole |
| Engelse naam |
6-chloroimidazo[2,1-b][1,3]thiazole; |
| MF |
C5H3ClN2S |
| Molecuulgewicht |
158.6087 |
| InChI |
InChI=1/C5H3ClN2S/c6-4-3-8-1-2-9-5(8)7-4/h1-3H |
| CAS-nummer |
23576-81-0 |
| Moleculaire Structuur |
![23576-81-0 6-chloroimidazo[2,1-b][1,3]thiazole](https://images-a.chemnet.com/suppliers/chembase/296/29635.gif)
|
| Dichtheid |
1.66g/cm3 |
| Smeltpunt |
82℃ |
| Brekingsindex |
1.78 |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
